C14H18N2O3 — CID 10945240
2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylacetonitrile (PubChem CID 10945240) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylacetonitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylacetonitrile |
|---|---|
| PubChem CID | 10945240 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylacetonitrile |
| SMILES | COc1ccc(C(C#N)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C14H18N2O3/c1-17-13-4-3-11(9-14(13)18-2)12(10-15)16-5-7-19-8-6-16/h3-4,9,12H,5-8H2,1-2H3 |
| InChIKey | OWTSANYWIHFQRL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |