C12H22F3N3 — CID 109452579
N',2,2,3,3-pentamethyl-N-(3,3,3-trifluoropropyl)azetidine-1-carboximidamide (PubChem CID 109452579) has the molecular formula C12H22F3N3 and a molecular weight of 265.32 g/mol. Its IUPAC name is N',2,2,3,3-pentamethyl-N-(3,3,3-trifluoropropyl)azetidine-1-carboximidamide.
| Compound Name | N',2,2,3,3-pentamethyl-N-(3,3,3-trifluoropropyl)azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109452579 |
| Molecular Formula | C12H22F3N3 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N',2,2,3,3-pentamethyl-N-(3,3,3-trifluoropropyl)azetidine-1-carboximidamide |
| SMILES | C/N=C(\NCCC(F)(F)F)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C12H22F3N3/c1-10(2)8-18(11(10,3)4)9(16-5)17-7-6-12(13,14)15/h6-8H2,1-5H3,(H,16,17) |
| InChIKey | VULULRLSJNXVME-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|