About 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine
1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine (PubChem CID 10945284) has the molecular formula C14H25NSi2
and a molecular weight of 263.53 g/mol. Its IUPAC name is 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine.
Molecular Properties
| Compound Name | 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine |
| PubChem CID | 10945284 |
| Molecular Formula | C14H25NSi2 |
| Molecular Weight | 263.53 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine |
| SMILES | C/N=C/c1c([Si](C)(C)C)cccc1[Si](C)(C)C |
| InChI | InChI=1S/C14H25NSi2/c1-15-11-12-13(16(2,3)4)9-8-10-14(12)17(5,6)7/h8-11H,1-7H3/b15-11+ |
| InChIKey | XNQLXBQIGSRXJK-RVDMUPIBSA-N |
| XLogP | 2.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine?
The IUPAC name of 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine (CID 10945284) is 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine.
What is the SMILES notation for 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine?
The canonical SMILES for 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine is C/N=C/c1c([Si](C)(C)C)cccc1[Si](C)(C)C.
What is the InChIKey of 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine?
The InChIKey is XNQLXBQIGSRXJK-RVDMUPIBSA-N. The full InChI is InChI=1S/C14H25NSi2/c1-15-11-12-13(16(2,3)4)9-8-10-14(12)17(5,6)7/h8-11H,1-7H3/b15-11+.
What are the key properties of 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine?
1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine has a molecular weight of 263.53 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-bis(trimethylsilyl)phenyl]-N-methylmethanimine is sourced from PubChem (CID 10945284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).