C12H24IN3 — CID 109453032
N',2,2,3,3-pentamethyl-N-prop-2-enylazetidine-1-carboximidamide;hydroiodide (PubChem CID 109453032) has the molecular formula C12H24IN3 and a molecular weight of 337.25 g/mol. Its IUPAC name is N',2,2,3,3-pentamethyl-N-prop-2-enylazetidine-1-carboximidamide;hydroiodide.
| Compound Name | N',2,2,3,3-pentamethyl-N-prop-2-enylazetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109453032 |
| Molecular Formula | C12H24IN3 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N',2,2,3,3-pentamethyl-N-prop-2-enylazetidine-1-carboximidamide;hydroiodide |
| SMILES | C=CCN/C(=N\C)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C12H23N3.HI/c1-7-8-14-10(13-6)15-9-11(2,3)12(15,4)5;/h7H,1,8-9H2,2-6H3,(H,13,14);1H |
| InChIKey | ZYOSMUVNUISVIF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|