C15H20O4 — CID 10945309
methyl (3aR,4R,7aS)-7a-methyl-1,5-dioxo-4-prop-2-enyl-3,3a,6,7-tetrahydro-2H-indene-4-carboxylate (PubChem CID 10945309) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl (3aR,4R,7aS)-7a-methyl-1,5-dioxo-4-prop-2-enyl-3,3a,6,7-tetrahydro-2H-indene-4-carboxylate.
| Compound Name | methyl (3aR,4R,7aS)-7a-methyl-1,5-dioxo-4-prop-2-enyl-3,3a,6,7-tetrahydro-2H-indene-4-carboxylate |
|---|---|
| PubChem CID | 10945309 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | methyl (3aR,4R,7aS)-7a-methyl-1,5-dioxo-4-prop-2-enyl-3,3a,6,7-tetrahydro-2H-indene-4-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)C(=O)CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C15H20O4/c1-4-8-15(13(18)19-3)10-5-6-11(16)14(10,2)9-7-12(15)17/h4,10H,1,5-9H2,2-3H3/t10-,14+,15-/m1/s1 |
| InChIKey | AQWFAAKTKCIKJS-WKPIXPDZSA-N |
| XLogP | 2.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|