C19H37N3O — CID 109453560
N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide (PubChem CID 109453560) has the molecular formula C19H37N3O and a molecular weight of 323.53 g/mol. Its IUPAC name is N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide.
| Compound Name | N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109453560 |
| Molecular Formula | C19H37N3O |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.29 |
| IUPAC Name | N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
| SMILES | CCOCCC1(CN/C(=N\C)N2CC(C)(C)C2(C)C)CCCC1 |
| InChI | InChI=1S/C19H37N3O/c1-7-23-13-12-19(10-8-9-11-19)14-21-16(20-6)22-15-17(2,3)18(22,4)5/h7-15H2,1-6H3,(H,20,21) |
| InChIKey | KOUALAGCOZVWFJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|