C16H30OSi — CID 10945392
[(4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]oxy-trimethylsilane (PubChem CID 10945392) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is [(4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]oxy-trimethylsilane.
| Compound Name | [(4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10945392 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | [(4aS,8aS)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]oxy-trimethylsilane |
| SMILES | CC1(C)CCC[C@]2(C)C(O[Si](C)(C)C)=CCC[C@@H]12 |
| InChI | InChI=1S/C16H30OSi/c1-15(2)11-8-12-16(3)13(15)9-7-10-14(16)17-18(4,5)6/h10,13H,7-9,11-12H2,1-6H3/t13-,16-/m0/s1 |
| InChIKey | QVGAVCHHZXWCJR-BBRMVZONSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|