C17H29IN4O — CID 109454385
N-ethyl-N'-[(2-methoxy-3-pyridinyl)methyl]-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide (PubChem CID 109454385) has the molecular formula C17H29IN4O and a molecular weight of 432.35 g/mol. Its IUPAC name is N-ethyl-N'-[(2-methoxy-3-pyridinyl)methyl]-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(2-methoxy-3-pyridinyl)methyl]-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109454385 |
| Molecular Formula | C17H29IN4O |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-ethyl-N'-[(2-methoxy-3-pyridinyl)methyl]-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OC)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C17H28N4O.HI/c1-7-18-15(21-12-16(2,3)17(21,4)5)20-11-13-9-8-10-19-14(13)22-6;/h8-10H,7,11-12H2,1-6H3,(H,18,20);1H |
| InChIKey | WVISKZRQWAQYMI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|