C17H29F3IN5OS — CID 109454849
2-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 109454849) has the molecular formula C17H29F3IN5OS and a molecular weight of 535.42 g/mol. Its IUPAC name is 2-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109454849 |
| Molecular Formula | C17H29F3IN5OS |
| Molecular Weight | 535.42 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 2-ethyl-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CC/N=C(/NC1CCN(CC(F)(F)F)C1)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C17H28F3N5OS.HI/c1-5-21-16(23-13-6-7-25(9-13)11-17(18,19)20)24(3)8-14-10-27-15(22-14)12(2)26-4;/h10,12-13H,5-9,11H2,1-4H3,(H,21,23);1H |
| InChIKey | WXFBANFAVSRFKY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|