C15H14ClN3 — CID 10945567
3-(2-chloro-3-pyridinyl)-2-methyl-5,6,7,8-tetrahydroindolizine-1-carbonitrile (PubChem CID 10945567) has the molecular formula C15H14ClN3 and a molecular weight of 271.75 g/mol. Its IUPAC name is 3-(2-chloro-3-pyridinyl)-2-methyl-5,6,7,8-tetrahydroindolizine-1-carbonitrile.
| Compound Name | 3-(2-chloro-3-pyridinyl)-2-methyl-5,6,7,8-tetrahydroindolizine-1-carbonitrile |
|---|---|
| PubChem CID | 10945567 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 3-(2-chloro-3-pyridinyl)-2-methyl-5,6,7,8-tetrahydroindolizine-1-carbonitrile |
| SMILES | Cc1c(C#N)c2n(c1-c1cccnc1Cl)CCCC2 |
| InChI | InChI=1S/C15H14ClN3/c1-10-12(9-17)13-6-2-3-8-19(13)14(10)11-5-4-7-18-15(11)16/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | WHTCJIWIEXSHDA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|