About diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate
diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 1094567) has the molecular formula C19H20BrNO6
and a molecular weight of 438.27 g/mol. Its IUPAC name is diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate |
| PubChem CID | 1094567 |
| Molecular Formula | C19H20BrNO6 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CN(C)C=C(C(=O)OCC)C1c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C19H20BrNO6/c1-4-24-18(22)12-8-21(3)9-13(19(23)25-5-2)17(12)11-6-15-16(7-14(11)20)27-10-26-15/h6-9,17H,4-5,10H2,1-3H3 |
| InChIKey | JCYOZAHFBKBZRS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate?
The IUPAC name of diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate (CID 1094567) is diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate.
What is the SMILES notation for diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate?
The canonical SMILES for diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate is CCOC(=O)C1=CN(C)C=C(C(=O)OCC)C1c1cc2c(cc1Br)OCO2.
What is the InChIKey of diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate?
The InChIKey is JCYOZAHFBKBZRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20BrNO6/c1-4-24-18(22)12-8-21(3)9-13(19(23)25-5-2)17(12)11-6-15-16(7-14(11)20)27-10-26-15/h6-9,17H,4-5,10H2,1-3H3.
What are the key properties of diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate?
diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate has a molecular weight of 438.27 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-(6-bromo-1,3-benzodioxol-5-yl)-1-methyl-4H-pyridine-3,5-dicarboxylate is sourced from PubChem (CID 1094567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).