C16H28F3N5OS — CID 109456728
1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine (PubChem CID 109456728) has the molecular formula C16H28F3N5OS and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine.
| Compound Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 109456728 |
| Molecular Formula | C16H28F3N5OS |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)N(C)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C16H28F3N5OS/c1-12(25-5)14-22-13(10-26-14)9-24(4)15(20-2)21-7-6-8-23(3)11-16(17,18)19/h10,12H,6-9,11H2,1-5H3,(H,20,21) |
| InChIKey | JKGKZMCTIKTOJE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|