C16H21NO3 — CID 10945679
(1R,3S,8R,9R,10S,12R)-10-hydroxy-5-methyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-15-ene-4,14-dione (PubChem CID 10945679) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (1R,3S,8R,9R,10S,12R)-10-hydroxy-5-methyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-15-ene-4,14-dione.
| Compound Name | (1R,3S,8R,9R,10S,12R)-10-hydroxy-5-methyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-15-ene-4,14-dione |
|---|---|
| PubChem CID | 10945679 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (1R,3S,8R,9R,10S,12R)-10-hydroxy-5-methyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-15-ene-4,14-dione |
| SMILES | CN1CC[C@@H]2[C@H]3[C@@H](O)C[C@@H]4CC(=O)C=C[C@@]43C[C@@H]2C1=O |
| InChI | InChI=1S/C16H21NO3/c1-17-5-3-11-12(15(17)20)8-16-4-2-10(18)6-9(16)7-13(19)14(11)16/h2,4,9,11-14,19H,3,5-8H2,1H3/t9-,11-,12-,13-,14-,16+/m0/s1 |
| InChIKey | LNRHMFMCMLNUTC-RDVNKRSCSA-N |
| XLogP | 1.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |