C23H33ClIN5 — CID 109457413
1-(1-benzyl-2-methylpiperidin-4-yl)-2-[2-(6-chloro-3-pyridinyl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 109457413) has the molecular formula C23H33ClIN5 and a molecular weight of 541.91 g/mol. Its IUPAC name is 1-(1-benzyl-2-methylpiperidin-4-yl)-2-[2-(6-chloro-3-pyridinyl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-[2-(6-chloro-3-pyridinyl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109457413 |
| Molecular Formula | C23H33ClIN5 |
| Molecular Weight | 541.91 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-[2-(6-chloro-3-pyridinyl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(Cl)nc1)NC1CCN(Cc2ccccc2)C(C)C1.I |
| InChI | InChI=1S/C23H32ClN5.HI/c1-3-25-23(26-13-11-19-9-10-22(24)27-16-19)28-21-12-14-29(18(2)15-21)17-20-7-5-4-6-8-20;/h4-10,16,18,21H,3,11-15,17H2,1-2H3,(H2,25,26,28);1H |
| InChIKey | CFOWOUXTLXRFHS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.91 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|