About 3,6-diphenylbenzene-1,2-dicarbonitrile
3,6-diphenylbenzene-1,2-dicarbonitrile (PubChem CID 10945840) has the molecular formula C20H12N2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 3,6-diphenylbenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3,6-diphenylbenzene-1,2-dicarbonitrile |
| PubChem CID | 10945840 |
| Molecular Formula | C20H12N2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 3,6-diphenylbenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)ccc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C20H12N2/c21-13-19-17(15-7-3-1-4-8-15)11-12-18(20(19)14-22)16-9-5-2-6-10-16/h1-12H |
| InChIKey | SKTSZLTUDJZCEX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-diphenylbenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diphenylbenzene-1,2-dicarbonitrile?
The IUPAC name of 3,6-diphenylbenzene-1,2-dicarbonitrile (CID 10945840) is 3,6-diphenylbenzene-1,2-dicarbonitrile.
What is the SMILES notation for 3,6-diphenylbenzene-1,2-dicarbonitrile?
The canonical SMILES for 3,6-diphenylbenzene-1,2-dicarbonitrile is N#Cc1c(-c2ccccc2)ccc(-c2ccccc2)c1C#N.
What is the InChIKey of 3,6-diphenylbenzene-1,2-dicarbonitrile?
The InChIKey is SKTSZLTUDJZCEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N2/c21-13-19-17(15-7-3-1-4-8-15)11-12-18(20(19)14-22)16-9-5-2-6-10-16/h1-12H.
What are the key properties of 3,6-diphenylbenzene-1,2-dicarbonitrile?
3,6-diphenylbenzene-1,2-dicarbonitrile has a molecular weight of 280.33 g/mol, XLogP of 4.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diphenylbenzene-1,2-dicarbonitrile is sourced from PubChem (CID 10945840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).