C14H21NO5 — CID 10945947
1-O-tert-butyl 2-O-methyl (2S,4S)-5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 10945947) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4S)-5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10945947 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-5-oxo-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CC[C@H]1C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C14H21NO5/c1-6-7-9-8-10(12(17)19-5)15(11(9)16)13(18)20-14(2,3)4/h6,9-10H,1,7-8H2,2-5H3/t9-,10-/m0/s1 |
| InChIKey | LAKCZWXMQPWQJK-UWVGGRQHSA-N |
| XLogP | 1.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|