About 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide
4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide (PubChem CID 109459634) has the molecular formula C14H21BrF2N6O
and a molecular weight of 407.26 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide.
Molecular Properties
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide |
| PubChem CID | 109459634 |
| Molecular Formula | C14H21BrF2N6O |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(F)F)N1CCN(c2ncc(Br)c(OC)n2)CC1 |
| InChI | InChI=1S/C14H21BrF2N6O/c1-3-18-13(20-9-11(16)17)22-4-6-23(7-5-22)14-19-8-10(15)12(21-14)24-2/h8,11H,3-7,9H2,1-2H3,(H,18,20) |
| InChIKey | ASTHOCFTIBRIMY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide?
The IUPAC name of 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide (CID 109459634) is 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide.
What is the SMILES notation for 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide?
The canonical SMILES for 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide is CCN/C(=N\CC(F)F)N1CCN(c2ncc(Br)c(OC)n2)CC1.
What is the InChIKey of 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide?
The InChIKey is ASTHOCFTIBRIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrF2N6O/c1-3-18-13(20-9-11(16)17)22-4-6-23(7-5-22)14-19-8-10(15)12(21-14)24-2/h8,11H,3-7,9H2,1-2H3,(H,18,20).
What are the key properties of 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide?
4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide has a molecular weight of 407.26 g/mol, XLogP of 1.60, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-4-methoxypyrimidin-2-yl)-N'-(2,2-difluoroethyl)-N-ethylpiperazine-1-carboximidamide is sourced from PubChem (CID 109459634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).