C22H37IN4O3S — CID 109460653
1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 109460653) has the molecular formula C22H37IN4O3S and a molecular weight of 564.53 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109460653 |
| Molecular Formula | C22H37IN4O3S |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(N2CCOCC2)CCSC1)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C22H36N4O3S.HI/c1-3-23-21(25-19-6-4-7-20(16-19)29-12-5-11-27-2)24-17-22(8-15-30-18-22)26-9-13-28-14-10-26;/h4,6-7,16H,3,5,8-15,17-18H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | UAHXJTCOWGXQLX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|