About [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate
[1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate (PubChem CID 10946109) has the molecular formula C8H17NO6S2
and a molecular weight of 287.36 g/mol. Its IUPAC name is [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate.
Molecular Properties
| Compound Name | [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate |
| PubChem CID | 10946109 |
| Molecular Formula | C8H17NO6S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate |
| SMILES | C[N+]1(C)CC(CS(=O)(=O)[O-])C(CS(=O)(=O)O)C1 |
| InChI | InChI=1S/C8H17NO6S2/c1-9(2)3-7(5-16(10,11)12)8(4-9)6-17(13,14)15/h7-8H,3-6H2,1-2H3,(H-,10,11,12,13,14,15) |
| InChIKey | SEQZZANAXZOQMO-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate?
The IUPAC name of [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate (CID 10946109) is [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate.
What is the SMILES notation for [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate?
The canonical SMILES for [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate is C[N+]1(C)CC(CS(=O)(=O)[O-])C(CS(=O)(=O)O)C1.
What is the InChIKey of [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate?
The InChIKey is SEQZZANAXZOQMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO6S2/c1-9(2)3-7(5-16(10,11)12)8(4-9)6-17(13,14)15/h7-8H,3-6H2,1-2H3,(H-,10,11,12,13,14,15).
What are the key properties of [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate?
[1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate has a molecular weight of 287.36 g/mol, XLogP of -1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-dimethyl-4-(sulfomethyl)pyrrolidin-1-ium-3-yl]methanesulfonate is sourced from PubChem (CID 10946109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).