C24H37IN6O2 — CID 109461201
1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine;hydroiodide (PubChem CID 109461201) has the molecular formula C24H37IN6O2 and a molecular weight of 568.50 g/mol. Its IUPAC name is 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109461201 |
| Molecular Formula | C24H37IN6O2 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN1CCN(c2ccc(CN/C(=N\C)Nc3cccc(OCCCOC)c3)cn2)CC1.I |
| InChI | InChI=1S/C24H36N6O2.HI/c1-4-29-11-13-30(14-12-29)23-10-9-20(18-26-23)19-27-24(25-2)28-21-7-5-8-22(17-21)32-16-6-15-31-3;/h5,7-10,17-18H,4,6,11-16,19H2,1-3H3,(H2,25,27,28);1H |
| InChIKey | TVQVSUUAHJXTGK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|