C20H32ClN5 — CID 109463184
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(1-ethylpiperidin-3-yl)methyl]-2-methylguanidine (PubChem CID 109463184) has the molecular formula C20H32ClN5 and a molecular weight of 377.96 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(1-ethylpiperidin-3-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(1-ethylpiperidin-3-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109463184 |
| Molecular Formula | C20H32ClN5 |
| Molecular Weight | 377.96 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(1-ethylpiperidin-3-yl)methyl]-2-methylguanidine |
| SMILES | CCN1CCCC(CN/C(=N\C)NC2CCN(c3cccc(Cl)c3)C2)C1 |
| InChI | InChI=1S/C20H32ClN5/c1-3-25-10-5-6-16(14-25)13-23-20(22-2)24-18-9-11-26(15-18)19-8-4-7-17(21)12-19/h4,7-8,12,16,18H,3,5-6,9-11,13-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | RIHUSZUFGXFPLJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.96 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|