C17H26O4 — CID 10946323
methyl 2-[(8S,9R)-9-(2-methylidenebutyl)-1,4-dioxaspiro[4.4]nonan-8-yl]but-3-enoate (PubChem CID 10946323) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl 2-[(8S,9R)-9-(2-methylidenebutyl)-1,4-dioxaspiro[4.4]nonan-8-yl]but-3-enoate.
| Compound Name | methyl 2-[(8S,9R)-9-(2-methylidenebutyl)-1,4-dioxaspiro[4.4]nonan-8-yl]but-3-enoate |
|---|---|
| PubChem CID | 10946323 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methyl 2-[(8S,9R)-9-(2-methylidenebutyl)-1,4-dioxaspiro[4.4]nonan-8-yl]but-3-enoate |
| SMILES | C=CC(C(=O)OC)[C@H]1CCC2(OCCO2)[C@@H]1CC(=C)CC |
| InChI | InChI=1S/C17H26O4/c1-5-12(3)11-15-14(13(6-2)16(18)19-4)7-8-17(15)20-9-10-21-17/h6,13-15H,2-3,5,7-11H2,1,4H3/t13?,14-,15-/m1/s1 |
| InChIKey | VVYKMMGXHVKNIF-JVIGXAJISA-N |
| XLogP | 3.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|