C15H25NO3Si — CID 10946366
N-benzyl-4-methoxy-3-trimethylsilyloxybutanamide (PubChem CID 10946366) has the molecular formula C15H25NO3Si and a molecular weight of 295.45 g/mol. Its IUPAC name is N-benzyl-4-methoxy-3-trimethylsilyloxybutanamide.
| Compound Name | N-benzyl-4-methoxy-3-trimethylsilyloxybutanamide |
|---|---|
| PubChem CID | 10946366 |
| Molecular Formula | C15H25NO3Si |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-benzyl-4-methoxy-3-trimethylsilyloxybutanamide |
| SMILES | COCC(CC(=O)NCc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C15H25NO3Si/c1-18-12-14(19-20(2,3)4)10-15(17)16-11-13-8-6-5-7-9-13/h5-9,14H,10-12H2,1-4H3,(H,16,17) |
| InChIKey | ZKOYQXYENCRVOP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|