C16H21Cl3IN5O — CID 109464401
1-ethyl-2-[(1-methylpyrazol-4-yl)methyl]-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide (PubChem CID 109464401) has the molecular formula C16H21Cl3IN5O and a molecular weight of 532.64 g/mol. Its IUPAC name is 1-ethyl-2-[(1-methylpyrazol-4-yl)methyl]-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(1-methylpyrazol-4-yl)methyl]-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109464401 |
| Molecular Formula | C16H21Cl3IN5O |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 530.99 |
| IUPAC Name | 1-ethyl-2-[(1-methylpyrazol-4-yl)methyl]-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnn(C)c1)NCCOc1c(Cl)cc(Cl)cc1Cl.I |
| InChI | InChI=1S/C16H20Cl3N5O.HI/c1-3-20-16(22-8-11-9-23-24(2)10-11)21-4-5-25-15-13(18)6-12(17)7-14(15)19;/h6-7,9-10H,3-5,8H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | WROIECZMZAKPQC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|