C20H26O2 — CID 10946461
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] but-2-ynoate (PubChem CID 10946461) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] but-2-ynoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] but-2-ynoate |
|---|---|
| PubChem CID | 10946461 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] but-2-ynoate |
| SMILES | CC#CC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H26O2/c1-5-9-19(21)22-18-14-15(2)12-13-17(18)20(3,4)16-10-7-6-8-11-16/h6-8,10-11,15,17-18H,12-14H2,1-4H3/t15-,17-,18-/m1/s1 |
| InChIKey | NDLZKFXUJHUBSH-KBAYOESNSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|