C19H38O2 — CID 10946465
[(2S,3S,7R)-3,7-dimethylpentadecan-2-yl] acetate (PubChem CID 10946465) has the molecular formula C19H38O2 and a molecular weight of 298.51 g/mol. Its IUPAC name is [(2S,3S,7R)-3,7-dimethylpentadecan-2-yl] acetate.
| Compound Name | [(2S,3S,7R)-3,7-dimethylpentadecan-2-yl] acetate |
|---|---|
| PubChem CID | 10946465 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | [(2S,3S,7R)-3,7-dimethylpentadecan-2-yl] acetate |
| SMILES | CCCCCCCC[C@@H](C)CCC[C@H](C)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C19H38O2/c1-6-7-8-9-10-11-13-16(2)14-12-15-17(3)18(4)21-19(5)20/h16-18H,6-15H2,1-5H3/t16-,17+,18+/m1/s1 |
| InChIKey | ZFWYAIZIMZGTBY-SQNIBIBYSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|