C20H34N4O — CID 109465150
3-[[N-[2-(4-ethylphenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide (PubChem CID 109465150) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is 3-[[N-[2-(4-ethylphenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide.
| Compound Name | 3-[[N-[2-(4-ethylphenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 109465150 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 3-[[N-[2-(4-ethylphenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCN/C(=N\C)NCC(C)(C)c1ccc(CC)cc1 |
| InChI | InChI=1S/C20H34N4O/c1-6-13-22-18(25)12-14-23-19(21-5)24-15-20(3,4)17-10-8-16(7-2)9-11-17/h8-11H,6-7,12-15H2,1-5H3,(H,22,25)(H2,21,23,24) |
| InChIKey | OPAGEHXMMLSEMV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|