C20H30N4O5 — CID 109465460
tert-butyl 3-[[N-[(4-methoxy-3-methoxycarbonylphenyl)methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465460) has the molecular formula C20H30N4O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is tert-butyl 3-[[N-[(4-methoxy-3-methoxycarbonylphenyl)methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-[(4-methoxy-3-methoxycarbonylphenyl)methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465460 |
| Molecular Formula | C20H30N4O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | tert-butyl 3-[[N-[(4-methoxy-3-methoxycarbonylphenyl)methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCc1ccc(OC)c(C(=O)OC)c1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H30N4O5/c1-20(2,3)29-19(26)24-11-14(12-24)23-18(21-4)22-10-13-7-8-16(27-5)15(9-13)17(25)28-6/h7-9,14H,10-12H2,1-6H3,(H2,21,22,23) |
| InChIKey | LQJRDYLFNUXFIJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|