C16H17NO5 — CID 10946614
methyl N-[4-(4-tert-butylphenyl)-2,5-dioxofuran-3-yl]carbamate (PubChem CID 10946614) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is methyl N-[4-(4-tert-butylphenyl)-2,5-dioxofuran-3-yl]carbamate.
| Compound Name | methyl N-[4-(4-tert-butylphenyl)-2,5-dioxofuran-3-yl]carbamate |
|---|---|
| PubChem CID | 10946614 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | methyl N-[4-(4-tert-butylphenyl)-2,5-dioxofuran-3-yl]carbamate |
| SMILES | COC(=O)NC1=C(c2ccc(C(C)(C)C)cc2)C(=O)OC1=O |
| InChI | InChI=1S/C16H17NO5/c1-16(2,3)10-7-5-9(6-8-10)11-12(17-15(20)21-4)14(19)22-13(11)18/h5-8H,1-4H3,(H,17,20) |
| InChIKey | DGRFDENFUIVIFK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|