C19H34F3N5O2 — CID 109466972
tert-butyl 3-[[N'-methyl-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109466972) has the molecular formula C19H34F3N5O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is tert-butyl 3-[[N'-methyl-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N'-methyl-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109466972 |
| Molecular Formula | C19H34F3N5O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | tert-butyl 3-[[N'-methyl-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCCC1CCN(CC(F)(F)F)CC1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H34F3N5O2/c1-18(2,3)29-17(28)27-11-15(12-27)25-16(23-4)24-8-5-14-6-9-26(10-7-14)13-19(20,21)22/h14-15H,5-13H2,1-4H3,(H2,23,24,25) |
| InChIKey | ZNQRIVFLMOHULV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|