C11H25N3OS — CID 109467688
1-(2-methoxyethyl)-2-[3-(2-methylpropylsulfanyl)propyl]guanidine (PubChem CID 109467688) has the molecular formula C11H25N3OS and a molecular weight of 247.41 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-[3-(2-methylpropylsulfanyl)propyl]guanidine.
| Compound Name | 1-(2-methoxyethyl)-2-[3-(2-methylpropylsulfanyl)propyl]guanidine |
|---|---|
| PubChem CID | 109467688 |
| Molecular Formula | C11H25N3OS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-(2-methoxyethyl)-2-[3-(2-methylpropylsulfanyl)propyl]guanidine |
| SMILES | COCCN/C(N)=N/CCCSCC(C)C |
| InChI | InChI=1S/C11H25N3OS/c1-10(2)9-16-8-4-5-13-11(12)14-6-7-15-3/h10H,4-9H2,1-3H3,(H3,12,13,14) |
| InChIKey | BGHDLPZFEJHIGU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|