About 11-hydroxyicosa-1,19-dien-10-one
11-hydroxyicosa-1,19-dien-10-one (PubChem CID 10946786) has the molecular formula C20H36O2
and a molecular weight of 308.51 g/mol. Its IUPAC name is 11-hydroxyicosa-1,19-dien-10-one.
Molecular Properties
| Compound Name | 11-hydroxyicosa-1,19-dien-10-one |
| PubChem CID | 10946786 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 11-hydroxyicosa-1,19-dien-10-one |
| SMILES | C=CCCCCCCCC(=O)C(O)CCCCCCCC=C |
| InChI | InChI=1S/C20H36O2/c1-3-5-7-9-11-13-15-17-19(21)20(22)18-16-14-12-10-8-6-4-2/h3-4,19,21H,1-2,5-18H2 |
| InChIKey | KEDBAPQHFPWRHE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-hydroxyicosa-1,19-dien-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-hydroxyicosa-1,19-dien-10-one?
The IUPAC name of 11-hydroxyicosa-1,19-dien-10-one (CID 10946786) is 11-hydroxyicosa-1,19-dien-10-one.
What is the SMILES notation for 11-hydroxyicosa-1,19-dien-10-one?
The canonical SMILES for 11-hydroxyicosa-1,19-dien-10-one is C=CCCCCCCCC(=O)C(O)CCCCCCCC=C.
What is the InChIKey of 11-hydroxyicosa-1,19-dien-10-one?
The InChIKey is KEDBAPQHFPWRHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O2/c1-3-5-7-9-11-13-15-17-19(21)20(22)18-16-14-12-10-8-6-4-2/h3-4,19,21H,1-2,5-18H2.
What are the key properties of 11-hydroxyicosa-1,19-dien-10-one?
11-hydroxyicosa-1,19-dien-10-one has a molecular weight of 308.51 g/mol, XLogP of 5.75, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-hydroxyicosa-1,19-dien-10-one is sourced from PubChem (CID 10946786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).