C10H8ClN6O2P — CID 10946851
1-[(2-chlorophenoxy)-(1,2,4-triazol-1-yl)phosphoryl]-1,2,4-triazole (PubChem CID 10946851) has the molecular formula C10H8ClN6O2P and a molecular weight of 310.64 g/mol. Its IUPAC name is 1-[(2-chlorophenoxy)-(1,2,4-triazol-1-yl)phosphoryl]-1,2,4-triazole.
| Compound Name | 1-[(2-chlorophenoxy)-(1,2,4-triazol-1-yl)phosphoryl]-1,2,4-triazole |
|---|---|
| PubChem CID | 10946851 |
| Molecular Formula | C10H8ClN6O2P |
| Molecular Weight | 310.64 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 1-[(2-chlorophenoxy)-(1,2,4-triazol-1-yl)phosphoryl]-1,2,4-triazole |
| SMILES | O=P(Oc1ccccc1Cl)(n1cncn1)n1cncn1 |
| InChI | InChI=1S/C10H8ClN6O2P/c11-9-3-1-2-4-10(9)19-20(18,16-7-12-5-14-16)17-8-13-6-15-17/h1-8H |
| InChIKey | SULZNMWOSINOKT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|