C18H34F3IN4 — CID 109469256
1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide (PubChem CID 109469256) has the molecular formula C18H34F3IN4 and a molecular weight of 490.40 g/mol. Its IUPAC name is 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109469256 |
| Molecular Formula | C18H34F3IN4 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCC1(CN/C(=N\C)NCCC2CCN(CC(F)(F)F)CC2)CCC1.I |
| InChI | InChI=1S/C18H33F3N4.HI/c1-3-17(8-4-9-17)13-24-16(22-2)23-10-5-15-6-11-25(12-7-15)14-18(19,20)21;/h15H,3-14H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | NIXSIIINRDYPGO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|