C12H24IN3 — CID 109469711
1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide (PubChem CID 109469711) has the molecular formula C12H24IN3 and a molecular weight of 337.25 g/mol. Its IUPAC name is 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109469711 |
| Molecular Formula | C12H24IN3 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCC1(CC)CCC1.I |
| InChI | InChI=1S/C12H23N3.HI/c1-4-9-14-11(13-3)15-10-12(5-2)7-6-8-12;/h4H,1,5-10H2,2-3H3,(H2,13,14,15);1H |
| InChIKey | CEINBAFBGKNKHO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|