C11H21F2N3 — CID 109469866
1-(2,2-difluoroethyl)-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine (PubChem CID 109469866) has the molecular formula C11H21F2N3 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine.
| Compound Name | 1-(2,2-difluoroethyl)-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109469866 |
| Molecular Formula | C11H21F2N3 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine |
| SMILES | CCC1(CN/C(=N/C)NCC(F)F)CCC1 |
| InChI | InChI=1S/C11H21F2N3/c1-3-11(5-4-6-11)8-16-10(14-2)15-7-9(12)13/h9H,3-8H2,1-2H3,(H2,14,15,16) |
| InChIKey | SHMMTARHDUPPGY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|