C15H31IN4 — CID 109470633
1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine;hydroiodide (PubChem CID 109470633) has the molecular formula C15H31IN4 and a molecular weight of 394.35 g/mol. Its IUPAC name is 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109470633 |
| Molecular Formula | C15H31IN4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCC1(CN/C(=N\C)NCC2CCN(C)C2)CCC1.I |
| InChI | InChI=1S/C15H30N4.HI/c1-4-15(7-5-8-15)12-18-14(16-2)17-10-13-6-9-19(3)11-13;/h13H,4-12H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | JZHKQQMAPHSSNH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|