C15H32N4 — CID 109470846
1-ethyl-2-[(1-ethylcyclobutyl)methyl]-3-[2-[ethyl(methyl)amino]ethyl]guanidine (PubChem CID 109470846) has the molecular formula C15H32N4 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-ethyl-2-[(1-ethylcyclobutyl)methyl]-3-[2-[ethyl(methyl)amino]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(1-ethylcyclobutyl)methyl]-3-[2-[ethyl(methyl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 109470846 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | 1-ethyl-2-[(1-ethylcyclobutyl)methyl]-3-[2-[ethyl(methyl)amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CC1(CC)CCC1)NCCN(C)CC |
| InChI | InChI=1S/C15H32N4/c1-5-15(9-8-10-15)13-18-14(16-6-2)17-11-12-19(4)7-3/h5-13H2,1-4H3,(H2,16,17,18) |
| InChIKey | WMKQSJQWNUHNHN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|