C19H26O2S — CID 10947110
(1S,2E,4R,8R)-4-(benzenesulfinyl)-1-ethyl-2-propylidene-9-oxabicyclo[6.1.0]nonane (PubChem CID 10947110) has the molecular formula C19H26O2S and a molecular weight of 318.48 g/mol. Its IUPAC name is (1S,2E,4R,8R)-4-(benzenesulfinyl)-1-ethyl-2-propylidene-9-oxabicyclo[6.1.0]nonane.
| Compound Name | (1S,2E,4R,8R)-4-(benzenesulfinyl)-1-ethyl-2-propylidene-9-oxabicyclo[6.1.0]nonane |
|---|---|
| PubChem CID | 10947110 |
| Molecular Formula | C19H26O2S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (1S,2E,4R,8R)-4-(benzenesulfinyl)-1-ethyl-2-propylidene-9-oxabicyclo[6.1.0]nonane |
| SMILES | CC/C=C1\C[C@H](S(=O)c2ccccc2)CCC[C@H]2O[C@@]12CC |
| InChI | InChI=1S/C19H26O2S/c1-3-9-15-14-17(22(20)16-10-6-5-7-11-16)12-8-13-18-19(15,4-2)21-18/h5-7,9-11,17-18H,3-4,8,12-14H2,1-2H3/b15-9+/t17-,18-,19+,22?/m1/s1 |
| InChIKey | KIZNPRSJZGWLKE-DGKFFGDKSA-N |
| XLogP | 4.62 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|