C11H21F3IN3O2 — CID 109471252
propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 109471252) has the molecular formula C11H21F3IN3O2 and a molecular weight of 411.21 g/mol. Its IUPAC name is propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 109471252 |
| Molecular Formula | C11H21F3IN3O2 |
| Molecular Weight | 411.21 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)OC(C)C)NCCC(F)(F)F.I |
| InChI | InChI=1S/C11H20F3N3O2.HI/c1-8(2)19-9(18)4-6-16-10(15-3)17-7-5-11(12,13)14;/h8H,4-7H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | HBOMGEURXMIQSO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|