About propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate
propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate (PubChem CID 109471253) has the molecular formula C11H20F3N3O2
and a molecular weight of 283.29 g/mol. Its IUPAC name is propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate.
Molecular Properties
| Compound Name | propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate |
| PubChem CID | 109471253 |
| Molecular Formula | C11H20F3N3O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate |
| SMILES | C/N=C(\NCCC(=O)OC(C)C)NCCC(F)(F)F |
| InChI | InChI=1S/C11H20F3N3O2/c1-8(2)19-9(18)4-6-16-10(15-3)17-7-5-11(12,13)14/h8H,4-7H2,1-3H3,(H2,15,16,17) |
| InChIKey | KHSSSJTTYIJYOC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate?
The IUPAC name of propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate (CID 109471253) is propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate.
What is the SMILES notation for propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate?
The canonical SMILES for propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate is C/N=C(\NCCC(=O)OC(C)C)NCCC(F)(F)F.
What is the InChIKey of propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate?
The InChIKey is KHSSSJTTYIJYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3N3O2/c1-8(2)19-9(18)4-6-16-10(15-3)17-7-5-11(12,13)14/h8H,4-7H2,1-3H3,(H2,15,16,17).
What are the key properties of propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate?
propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate has a molecular weight of 283.29 g/mol, XLogP of 1.45, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate is sourced from PubChem (CID 109471253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).