C12H26F3IN4 — CID 109471282
2-[2-(dimethylamino)-2-methylpropyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109471282) has the molecular formula C12H26F3IN4 and a molecular weight of 410.27 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-methylpropyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(dimethylamino)-2-methylpropyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109471282 |
| Molecular Formula | C12H26F3IN4 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[2-(dimethylamino)-2-methylpropyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)N(C)C)NCCC(F)(F)F.I |
| InChI | InChI=1S/C12H25F3N4.HI/c1-6-16-10(17-8-7-12(13,14)15)18-9-11(2,3)19(4)5;/h6-9H2,1-5H3,(H2,16,17,18);1H |
| InChIKey | NALMTPMTISWLAI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|