C13H26F3N3 — CID 109471361
1-(5,5-dimethylhexyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471361) has the molecular formula C13H26F3N3 and a molecular weight of 281.37 g/mol. Its IUPAC name is 1-(5,5-dimethylhexyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-(5,5-dimethylhexyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471361 |
| Molecular Formula | C13H26F3N3 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-(5,5-dimethylhexyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCCCC(C)(C)C)NCCC(F)(F)F |
| InChI | InChI=1S/C13H26F3N3/c1-12(2,3)7-5-6-9-18-11(17-4)19-10-8-13(14,15)16/h5-10H2,1-4H3,(H2,17,18,19) |
| InChIKey | JLTPDPLXNKSWCE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|