C10H20F3IN4O — CID 109471438
N,N-dimethyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 109471438) has the molecular formula C10H20F3IN4O and a molecular weight of 396.20 g/mol. Its IUPAC name is N,N-dimethyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N,N-dimethyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109471438 |
| Molecular Formula | C10H20F3IN4O |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N,N-dimethyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)N(C)C)NCCC(F)(F)F.I |
| InChI | InChI=1S/C10H19F3N4O.HI/c1-14-9(16-7-5-10(11,12)13)15-6-4-8(18)17(2)3;/h4-7H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | WRHOZPTZNSKUJB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|