C15H26F3N3O2 — CID 109471487
cyclopentyl 4-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]butanoate (PubChem CID 109471487) has the molecular formula C15H26F3N3O2 and a molecular weight of 337.39 g/mol. Its IUPAC name is cyclopentyl 4-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]butanoate.
| Compound Name | cyclopentyl 4-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]butanoate |
|---|---|
| PubChem CID | 109471487 |
| Molecular Formula | C15H26F3N3O2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | cyclopentyl 4-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]butanoate |
| SMILES | CCN/C(=N\CCCC(=O)OC1CCCC1)NCCC(F)(F)F |
| InChI | InChI=1S/C15H26F3N3O2/c1-2-19-14(21-11-9-15(16,17)18)20-10-5-8-13(22)23-12-6-3-4-7-12/h12H,2-11H2,1H3,(H2,19,20,21) |
| InChIKey | LFGUCOUVDLMPGS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|