About methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide
methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 109471784) has the molecular formula C9H17F3IN3O2
and a molecular weight of 383.15 g/mol. Its IUPAC name is methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide.
Molecular Properties
| Compound Name | methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide |
| PubChem CID | 109471784 |
| Molecular Formula | C9H17F3IN3O2 |
| Molecular Weight | 383.15 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)OC)NCCC(F)(F)F.I |
| InChI | InChI=1S/C9H16F3N3O2.HI/c1-13-8(14-5-3-7(16)17-2)15-6-4-9(10,11)12;/h3-6H2,1-2H3,(H2,13,14,15);1H |
| InChIKey | PXEKBUOPUJATPY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.15 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide?
The IUPAC name of methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide (CID 109471784) is methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide.
What is the SMILES notation for methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide?
The canonical SMILES for methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide is C/N=C(\NCCC(=O)OC)NCCC(F)(F)F.I.
What is the InChIKey of methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide?
The InChIKey is PXEKBUOPUJATPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3N3O2.HI/c1-13-8(14-5-3-7(16)17-2)15-6-4-9(10,11)12;/h3-6H2,1-2H3,(H2,13,14,15);1H.
What are the key properties of methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide?
methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide has a molecular weight of 383.15 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate;hydroiodide is sourced from PubChem (CID 109471784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).