C16H24F3IN4 — CID 109471898
1-[2-(2,3-dihydroindol-1-yl)propyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109471898) has the molecular formula C16H24F3IN4 and a molecular weight of 456.29 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)propyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)propyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109471898 |
| Molecular Formula | C16H24F3IN4 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)propyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC(C)N1CCc2ccccc21.I |
| InChI | InChI=1S/C16H23F3N4.HI/c1-12(23-10-7-13-5-3-4-6-14(13)23)11-22-15(20-2)21-9-8-16(17,18)19;/h3-6,12H,7-11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | FMCBHZBGPBSRGE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|