C14H28F3N3 — CID 109471907
2-(5,5-dimethylhexyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471907) has the molecular formula C14H28F3N3 and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-(5,5-dimethylhexyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-(5,5-dimethylhexyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471907 |
| Molecular Formula | C14H28F3N3 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.22 |
| IUPAC Name | 2-(5,5-dimethylhexyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCCCC(C)(C)C)NCCC(F)(F)F |
| InChI | InChI=1S/C14H28F3N3/c1-5-18-12(20-11-9-14(15,16)17)19-10-7-6-8-13(2,3)4/h5-11H2,1-4H3,(H2,18,19,20) |
| InChIKey | AYYJQXBAUVKWIT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|