C14H25F3N4O — CID 109471993
N-cyclohexyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide (PubChem CID 109471993) has the molecular formula C14H25F3N4O and a molecular weight of 322.38 g/mol. Its IUPAC name is N-cyclohexyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-cyclohexyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 109471993 |
| Molecular Formula | C14H25F3N4O |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-cyclohexyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(/NCCC(=O)NC1CCCCC1)NCCC(F)(F)F |
| InChI | InChI=1S/C14H25F3N4O/c1-18-13(20-10-8-14(15,16)17)19-9-7-12(22)21-11-5-3-2-4-6-11/h11H,2-10H2,1H3,(H,21,22)(H2,18,19,20) |
| InChIKey | DEBRTFIRNYCEND-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|