C12H24F3IN4O — CID 109472026
3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide (PubChem CID 109472026) has the molecular formula C12H24F3IN4O and a molecular weight of 424.25 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109472026 |
| Molecular Formula | C12H24F3IN4O |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
| SMILES | CCCNC(=O)CCN/C(=N/CCC(F)(F)F)NCC.I |
| InChI | InChI=1S/C12H23F3N4O.HI/c1-3-7-17-10(20)5-8-18-11(16-4-2)19-9-6-12(13,14)15;/h3-9H2,1-2H3,(H,17,20)(H2,16,18,19);1H |
| InChIKey | ZBMBNZPTZKKPPE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|